Products 108555-00-6
CAS 108555-00-6 is the registry number for 4-Nitrophenyl Sulfamate, 97%+(NMR),RG, 97%+(NMR),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(4-nitrophenyl) sulfamate (CAS 108555-00-6) is a chemical compound with the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. IUPAC name: (4-nitrophenyl) sulfamate. InChIKey: OLTVRSUIOUTBRQ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O5S |
|---|---|
| Molecular weight | 218.19 g/mol |
| IUPAC name | (4-nitrophenyl) sulfamate |
| InChIKey | OLTVRSUIOUTBRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)N |
Computed by PubChem (NCBI)