CAS 712-24-3 appears in our catalog under these names: 3–Nitroaniline–4–sulfonic Acid, 4-amino-2-nitrobenzenesulfonic acid, 95%, 4-Amino-2-nitrobenzenesulfonic acid, ≥94%(HPLC), ≥94%(HPLC). Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 1g.
4-amino-2-nitrobenzenesulfonic acid (CAS 712-24-3) is a chemical compound with the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. IUPAC name: 4-amino-2-nitrobenzenesulfonic acid. InChIKey: ZNMGCJDUZADKPW-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O5S |
|---|---|
| Molecular weight | 218.19 g/mol |
| IUPAC name | 4-amino-2-nitrobenzenesulfonic acid |
| InChIKey | ZNMGCJDUZADKPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])S(=O)(=O)O |
Computed by PubChem (NCBI)