CAS 616-84-2 appears in our catalog under these names: 2-Nitroaniline-4-sulfonic acid, 95%, 4-Amino-3-nitrobenzenesulfonic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g.
4-amino-3-nitrobenzenesulfonic acid (CAS 616-84-2) is a chemical compound with the molecular formula C6H6N2O5S and a molecular weight of 218.19 g/mol. IUPAC name: 4-amino-3-nitrobenzenesulfonic acid. InChIKey: VZLLZDZTQPBHAZ-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O5S |
|---|---|
| Molecular weight | 218.19 g/mol |
| IUPAC name | 4-amino-3-nitrobenzenesulfonic acid |
| InChIKey | VZLLZDZTQPBHAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)