Products 1086-11-9
CAS 1086-11-9 is the registry number for 2-(3-Fluorophenyl)-1H-indene-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-fluorophenyl)indene-1,3-dione (CAS 1086-11-9) is a chemical compound with the molecular formula C15H9FO2 and a molecular weight of 240.23 g/mol. IUPAC name: 2-(3-fluorophenyl)indene-1,3-dione. InChIKey: UAUATSHJDXYFHL-UHFFFAOYSA-N.
| Molecular formula | C15H9FO2 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 2-(3-fluorophenyl)indene-1,3-dione |
| InChIKey | UAUATSHJDXYFHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)