Products 1462877-66-2
CAS 1462877-66-2 is the registry number for 2-Fluoro-4-(phenylethynyl)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-4-(2-phenylethynyl)benzoic acid (CAS 1462877-66-2) is a chemical compound with the molecular formula C15H9FO2 and a molecular weight of 240.23 g/mol. IUPAC name: 2-fluoro-4-(2-phenylethynyl)benzoic acid. InChIKey: DRNAENLZTYGCTM-UHFFFAOYSA-N.
| Molecular formula | C15H9FO2 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 2-fluoro-4-(2-phenylethynyl)benzoic acid |
| InChIKey | DRNAENLZTYGCTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)