CAS 2558-18-1 appears in our catalog under these names: 4-Fluorobenzylidenephthalide, 95%, Olaparib Impurity 17. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, 5g, on request.
3-[(4-fluorophenyl)methylidene]-2-benzofuran-1-one (CAS 2558-18-1) is a chemical compound with the molecular formula C15H9FO2 and a molecular weight of 240.23 g/mol. IUPAC name: 3-[(4-fluorophenyl)methylidene]-2-benzofuran-1-one. InChIKey: YUUDPCAZITYZNH-UHFFFAOYSA-N.
| Molecular formula | C15H9FO2 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methylidene]-2-benzofuran-1-one |
| InChIKey | YUUDPCAZITYZNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=CC=C(C=C3)F)OC2=O |
Computed by PubChem (NCBI)