CAS 108629-56-7 is the registry number for Naphthalene-1,5-diyldimethanamine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
[5-(aminomethyl)naphthalen-1-yl]methanamine;dihydrochloride (CAS 108629-56-7) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: [5-(aminomethyl)naphthalen-1-yl]methanamine;dihydrochloride. InChIKey: FCXUYVVXJZKRGY-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | [5-(aminomethyl)naphthalen-1-yl]methanamine;dihydrochloride |
| InChIKey | FCXUYVVXJZKRGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)CN)CN.Cl.Cl |
Computed by PubChem (NCBI)