Products 1086386-13-1
CAS 1086386-13-1 is the registry number for 6-Iodo-2-methyl-2h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
6-iodo-2-methylindazole-3-carboxylic acid (CAS 1086386-13-1) is a chemical compound with the molecular formula C9H7IN2O2 and a molecular weight of 302.07 g/mol. IUPAC name: 6-iodo-2-methylindazole-3-carboxylic acid. InChIKey: HDQPZZQPFQBWEJ-UHFFFAOYSA-N.
| Molecular formula | C9H7IN2O2 |
|---|---|
| Molecular weight | 302.07 g/mol |
| IUPAC name | 6-iodo-2-methylindazole-3-carboxylic acid |
| InChIKey | HDQPZZQPFQBWEJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=CC(=CC2=N1)I)C(=O)O |
Computed by PubChem (NCBI)