Products 1086398-79-9
CAS 1086398-79-9 is the registry number for 2,4-Dichloroimidazo[5,1-f][1,2,4]triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloroimidazo[5,1-f][1,2,4]triazine (CAS 1086398-79-9) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,4-dichloroimidazo[5,1-f][1,2,4]triazine. InChIKey: HVOGNDAZVKZHOB-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,4-dichloroimidazo[5,1-f][1,2,4]triazine |
| InChIKey | HVOGNDAZVKZHOB-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=N1)Cl)Cl |
Computed by PubChem (NCBI)