CAS 108645-54-1 is the registry number for (-)-(E)-α-Atlantone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5E)-2-methyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]hepta-2,5-dien-4-one (CAS 108645-54-1) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (5E)-2-methyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]hepta-2,5-dien-4-one. InChIKey: OJEFBZMKKJTKKK-JWAFFJSPSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (5E)-2-methyl-6-[(1S)-4-methylcyclohex-3-en-1-yl]hepta-2,5-dien-4-one |
| InChIKey | OJEFBZMKKJTKKK-JWAFFJSPSA-N |
| SMILES | CC1=CC[C@H](CC1)/C(=C/C(=O)C=C(C)C)/C |
Computed by PubChem (NCBI)