Products 108748-88-5

CAS 108748-88-5 is the registry number for Ethyl Isonicotinimidate Hydrochloride. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl pyridine-4-carboximidate;hydrochloride (CAS 108748-88-5) is a chemical compound with the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. IUPAC name: ethyl pyridine-4-carboximidate;hydrochloride. InChIKey: HKUOIHRXVLNLQI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClN2O
Molecular weight186.64 g/mol
IUPAC nameethyl pyridine-4-carboximidate;hydrochloride
InChIKeyHKUOIHRXVLNLQI-UHFFFAOYSA-N
SMILESCCOC(=N)C1=CC=NC=C1.Cl

Computed by PubChem (NCBI)