CAS 1087715-00-1 is the registry number for Ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (CAS 1087715-00-1) is a chemical compound with the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. IUPAC name: ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: VOPQRTMRBFXCOK-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2S |
|---|---|
| Molecular weight | 298.79 g/mol |
| IUPAC name | ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
| InChIKey | VOPQRTMRBFXCOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)