Products 1087715-00-1

CAS 1087715-00-1 is the registry number for Ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (CAS 1087715-00-1) is a chemical compound with the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. IUPAC name: ethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: VOPQRTMRBFXCOK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15ClN2O2S
Molecular weight298.79 g/mol
IUPAC nameethyl 2-anilino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride
InChIKeyVOPQRTMRBFXCOK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C(S1)NC2=CC=CC=C2)C.Cl

Computed by PubChem (NCBI)