CAS 2089257-08-7 is the registry number for 1-(1,3-Benzothiazol-2-yl)piperidine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(1,3-benzothiazol-2-yl)piperidine-3-carboxylic acid;hydrochloride (CAS 2089257-08-7) is a chemical compound with the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)piperidine-3-carboxylic acid;hydrochloride. InChIKey: VZAHOIKICLTZCA-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2S |
|---|---|
| Molecular weight | 298.79 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)piperidine-3-carboxylic acid;hydrochloride |
| InChIKey | VZAHOIKICLTZCA-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC3=CC=CC=C3S2)C(=O)O.Cl |
Computed by PubChem (NCBI)