CAS 1700655-64-6 appears in our catalog under these names: 4-(piperazin-1-yl)-1-benzothiophene-2-carboxylic acid hydrochloride, 95%, 4-(1-Piperazinyl)-benzo(b)thiophene-2-carboxylic Acid Hydrochloride, 4-(PIPERAZIN-1-YL)BENZO(B)THIOPHENE-2-CARBOXYLIC ACID HCL, 95%, 4-(Piperazin-1-yl)-1-benzothiophene-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid;hydrochloride (CAS 1700655-64-6) is a chemical compound with the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. IUPAC name: 4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid;hydrochloride. InChIKey: ZZAIYAXTRXKSDE-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2S |
|---|---|
| Molecular weight | 298.79 g/mol |
| IUPAC name | 4-piperazin-1-yl-1-benzothiophene-2-carboxylic acid;hydrochloride |
| InChIKey | ZZAIYAXTRXKSDE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=C(SC3=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)