Products 1087768-73-7

CAS 1087768-73-7 is the registry number for 2-Methyl-1h-imidazole-4-carboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-methyl-1H-imidazole-5-carboxylic acid;hydrate (CAS 1087768-73-7) is a chemical compound with the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. IUPAC name: 2-methyl-1H-imidazole-5-carboxylic acid;hydrate. InChIKey: ZCMNRFBWTDHMAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8N2O3
Molecular weight144.13 g/mol
IUPAC name2-methyl-1H-imidazole-5-carboxylic acid;hydrate
InChIKeyZCMNRFBWTDHMAQ-UHFFFAOYSA-N
SMILESCC1=NC=C(N1)C(=O)O.O

Computed by PubChem (NCBI)