CAS 1240590-31-1 appears in our catalog under these names: (R)-5-Oxopiperazine-2-carboxylic acid, 95%, (R)-5-oxopiperazine-2-carboxylic acid, (2R)-5-Oxo-2-piperazinecarboxylic Acid, (R)-5-Oxopiperazine-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Chemat. Available pack sizes: 250mg, 1g, on request, 750mg.
(2R)-5-oxopiperazine-2-carboxylic acid (CAS 1240590-31-1) is a chemical compound with the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. IUPAC name: (2R)-5-oxopiperazine-2-carboxylic acid. InChIKey: CJFBRFWMGHQBFJ-GSVOUGTGSA-N.
| Molecular formula | C5H8N2O3 |
|---|---|
| Molecular weight | 144.13 g/mol |
| IUPAC name | (2R)-5-oxopiperazine-2-carboxylic acid |
| InChIKey | CJFBRFWMGHQBFJ-GSVOUGTGSA-N |
| SMILES | C1[C@@H](NCC(=O)N1)C(=O)O |
Computed by PubChem (NCBI)