Products 925890-01-3

CAS 925890-01-3 is the registry number for 3-Oxo-piperazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-oxopiperazine-2-carboxylic acid (CAS 925890-01-3) is a chemical compound with the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. IUPAC name: 3-oxopiperazine-2-carboxylic acid. InChIKey: GNDQTDPZWUAOIW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8N2O3
Molecular weight144.13 g/mol
IUPAC name3-oxopiperazine-2-carboxylic acid
InChIKeyGNDQTDPZWUAOIW-UHFFFAOYSA-N
SMILESC1CNC(=O)C(N1)C(=O)O

Computed by PubChem (NCBI)