CAS 1087784-70-0 is the registry number for 5-(Piperazine-1-sulfonyl)furan-2-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-piperazin-1-ylsulfonylfuran-2-carboxamide (CAS 1087784-70-0) is a chemical compound with the molecular formula C9H13N3O4S and a molecular weight of 259.28 g/mol. IUPAC name: 5-piperazin-1-ylsulfonylfuran-2-carboxamide. InChIKey: OXIAPQGSCKWZLP-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 5-piperazin-1-ylsulfonylfuran-2-carboxamide |
| InChIKey | OXIAPQGSCKWZLP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(O2)C(=O)N |
Computed by PubChem (NCBI)