CAS 1904611-13-7 is the registry number for Lamivudine Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.
4-(hydroxymethylamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 1904611-13-7) is a chemical compound with the molecular formula C9H13N3O4S and a molecular weight of 259.28 g/mol. IUPAC name: 4-(hydroxymethylamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: MSJYIKBYHWSMRA-JGVFFNPUSA-N.
| Molecular formula | C9H13N3O4S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 4-(hydroxymethylamino)-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | MSJYIKBYHWSMRA-JGVFFNPUSA-N |
| SMILES | C1[C@H](O[C@H](S1)CO)N2C=CC(=NC2=O)NCO |
Computed by PubChem (NCBI)