Products 108838-35-3
CAS 108838-35-3 appears in our catalog under these names: 2-(3-(2-Phenylacetyl)phenyl)acetic acid, 98%, Parecoxib Impurity 84. Offered by: AmBeed, Hubei YoungXin. Available pack sizes: 250mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[3-(2-phenylacetyl)phenyl]acetic acid (CAS 108838-35-3) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 2-[3-(2-phenylacetyl)phenyl]acetic acid. InChIKey: NXTHIQJMJFTDMR-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2-[3-(2-phenylacetyl)phenyl]acetic acid |
| InChIKey | NXTHIQJMJFTDMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)