CAS 108847-96-7 appears in our catalog under these names: 5-Bromo-6-chloroindolyl 1,3-diacetate, 98%, 1-Acetyl-5-bromo-6-chloro-1H-indol-3-yl acetate, 95+%, 5-Bromo-6-chloroindolyl 1,3-diacetate, 5-Bromo-6-chloroindolyl 1,3-diacetate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 25g, 1g, 2g, 10g, 50g, 50mg, 250mg.
(1-acetyl-5-bromo-6-chloroindol-3-yl) acetate (CAS 108847-96-7) is a chemical compound with the molecular formula C12H9BrClNO3 and a molecular weight of 330.56 g/mol. IUPAC name: (1-acetyl-5-bromo-6-chloroindol-3-yl) acetate. InChIKey: QOSOMKUVYQFRDU-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClNO3 |
|---|---|
| Molecular weight | 330.56 g/mol |
| IUPAC name | (1-acetyl-5-bromo-6-chloroindol-3-yl) acetate |
| InChIKey | QOSOMKUVYQFRDU-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=CC(=C(C=C21)Cl)Br)OC(=O)C |
Computed by PubChem (NCBI)