CAS 3030-06-6 appears in our catalog under these names: 1-Acetyl-5-bromo-4-chloro-1h-indol-3-yl acetate, 98%, 5-Bromo-4-chloro-3-indolyl-1,3-diacetate, 1–Acetyl–5–bromo–4–chloro–1H–indol–3–yl acetate, 1-Acetyl-5-bromo-4-chloro-3-indolyl Acetate, >98.0%(GC), 1-Acetyl-5-bromo-4-chloro-1H-indol-3-yl acetate 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 25mg, 100mg, 10g.
(1-acetyl-5-bromo-4-chloroindol-3-yl) acetate (CAS 3030-06-6) is a chemical compound with the molecular formula C12H9BrClNO3 and a molecular weight of 330.56 g/mol. IUPAC name: (1-acetyl-5-bromo-4-chloroindol-3-yl) acetate. InChIKey: DSHQTSIXXYZXGR-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClNO3 |
|---|---|
| Molecular weight | 330.56 g/mol |
| IUPAC name | (1-acetyl-5-bromo-4-chloroindol-3-yl) acetate |
| InChIKey | DSHQTSIXXYZXGR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2Cl)Br)OC(=O)C |
Computed by PubChem (NCBI)