CAS 70458-86-5 appears in our catalog under these names: 6-Bromo-7-chloro-1-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%, 95%, 6-Bromo-7-chloro-1-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
6-bromo-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid (CAS 70458-86-5) is a chemical compound with the molecular formula C12H9BrClNO3 and a molecular weight of 330.56 g/mol. IUPAC name: 6-bromo-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid. InChIKey: SCQCVNGDOVTSOH-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClNO3 |
|---|---|
| Molecular weight | 330.56 g/mol |
| IUPAC name | 6-bromo-7-chloro-1-ethyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | SCQCVNGDOVTSOH-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)