CAS 1088834-41-6 is the registry number for 3,5-Dichloro-1-(tetrahydro-2h-pyran-2-yl)-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
3,5-dichloro-1-(oxan-2-yl)-1,2,4-triazole (CAS 1088834-41-6) is a chemical compound with the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. IUPAC name: 3,5-dichloro-1-(oxan-2-yl)-1,2,4-triazole. InChIKey: COQOQVXWURFPDT-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3O |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 3,5-dichloro-1-(oxan-2-yl)-1,2,4-triazole |
| InChIKey | COQOQVXWURFPDT-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)