CAS 206559-50-4 appears in our catalog under these names: 4-(3-Chlorophenyl)semicarbazide hydrochloride, 98%, N-(3-Chlorophenyl)hydrazinecarboxamide hydrochloride, 97%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g, 2g, 10g, 5g.
1-amino-3-(3-chlorophenyl)urea;hydrochloride (CAS 206559-50-4) is a chemical compound with the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. IUPAC name: 1-amino-3-(3-chlorophenyl)urea;hydrochloride. InChIKey: JGYISWWFCUZOHY-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3O |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 1-amino-3-(3-chlorophenyl)urea;hydrochloride |
| InChIKey | JGYISWWFCUZOHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC(=O)NN.Cl |
Computed by PubChem (NCBI)