CAS 1172713-86-8 is the registry number for 2-Chloro-N-(pyrimidin-2-yl)propanamide hydrochloride, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g, 100mg.
2-chloro-N-pyrimidin-2-ylpropanamide;hydrochloride (CAS 1172713-86-8) is a chemical compound with the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. IUPAC name: 2-chloro-N-pyrimidin-2-ylpropanamide;hydrochloride. InChIKey: LBLGUKBPHVHYDX-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3O |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 2-chloro-N-pyrimidin-2-ylpropanamide;hydrochloride |
| InChIKey | LBLGUKBPHVHYDX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=NC=CC=N1)Cl.Cl |
Computed by PubChem (NCBI)