CAS 108920-21-4 appears in our catalog under these names: Rac-(1R,2R)-2-methanesulfonylcyclohexan-1-ol, 95%, rac-(1R,2R)-2-Methanesulfonylcyclohexan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Trans-(1R,2R)-2-methylsulfonylcyclohexan-1-ol (CAS 108920-21-4) is a chemical compound with the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. IUPAC name: trans-(1R,2R)-2-methylsulfonylcyclohexan-1-ol. InChIKey: GTUNVOKPLWUIGH-RNFRBKRXSA-N.
| Molecular formula | C7H14O3S |
|---|---|
| Molecular weight | 178.25 g/mol |
| IUPAC name | trans-(1R,2R)-2-methylsulfonylcyclohexan-1-ol |
| InChIKey | GTUNVOKPLWUIGH-RNFRBKRXSA-N |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@H]1O |
Computed by PubChem (NCBI)