Products 1089335-56-7
CAS 1089335-56-7 is the registry number for 2-Chloro-5-cyanonicotinic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
2-chloro-5-cyanopyridine-3-carboxylic acid (CAS 1089335-56-7) is a chemical compound with the molecular formula C7H3ClN2O2 and a molecular weight of 182.56 g/mol. IUPAC name: 2-chloro-5-cyanopyridine-3-carboxylic acid. InChIKey: ISJINFXUEGJXTJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O2 |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | 2-chloro-5-cyanopyridine-3-carboxylic acid |
| InChIKey | ISJINFXUEGJXTJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Cl)C#N |
Computed by PubChem (NCBI)