CAS 1090006-48-6 is the registry number for 2-Chloro-5-pivalamidobenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-(2,2-dimethylpropanoylamino)benzamide (CAS 1090006-48-6) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-chloro-5-(2,2-dimethylpropanoylamino)benzamide. InChIKey: KRRYIFMPQKZXIZ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-chloro-5-(2,2-dimethylpropanoylamino)benzamide |
| InChIKey | KRRYIFMPQKZXIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)Cl)C(=O)N |
Computed by PubChem (NCBI)