Products 1090015-86-3
CAS 1090015-86-3 is the registry number for 2-(2,4-Dichlorophenoxy)-N-(2-hydroxypropyl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenoxy)-N-(2-hydroxypropyl)propanamide (CAS 1090015-86-3) is a chemical compound with the molecular formula C12H15Cl2NO3 and a molecular weight of 292.15 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-(2-hydroxypropyl)propanamide. InChIKey: XWCHSWFCYUFQPH-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO3 |
|---|---|
| Molecular weight | 292.15 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-(2-hydroxypropyl)propanamide |
| InChIKey | XWCHSWFCYUFQPH-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)C(C)OC1=C(C=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)