Products 1956306-19-6

CAS 1956306-19-6 is the registry number for (2-Chloro-phenyl)-morpholin-4-yl-acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)-2-morpholin-4-ylacetic acid;hydrochloride (CAS 1956306-19-6) is a chemical compound with the molecular formula C12H15Cl2NO3 and a molecular weight of 292.15 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-morpholin-4-ylacetic acid;hydrochloride. InChIKey: PTXXOKAOJDLSHX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15Cl2NO3
Molecular weight292.15 g/mol
IUPAC name2-(2-chlorophenyl)-2-morpholin-4-ylacetic acid;hydrochloride
InChIKeyPTXXOKAOJDLSHX-UHFFFAOYSA-N
SMILESC1COCCN1C(C2=CC=CC=C2Cl)C(=O)O.Cl

Computed by PubChem (NCBI)