CAS 1372096-34-8 is the registry number for 2-(N-Boc-aminomethyl)-4,6-dichlorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl N-[(3,5-dichloro-2-hydroxyphenyl)methyl]carbamate (CAS 1372096-34-8) is a chemical compound with the molecular formula C12H15Cl2NO3 and a molecular weight of 292.15 g/mol. IUPAC name: tert-butyl N-[(3,5-dichloro-2-hydroxyphenyl)methyl]carbamate. InChIKey: YQARRNHMSFYCOQ-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO3 |
|---|---|
| Molecular weight | 292.15 g/mol |
| IUPAC name | tert-butyl N-[(3,5-dichloro-2-hydroxyphenyl)methyl]carbamate |
| InChIKey | YQARRNHMSFYCOQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)