Products 1090335-04-8
CAS 1090335-04-8 is the registry number for Nurr1 agonist 11. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethylpropanamide (CAS 1090335-04-8) is a chemical compound with the molecular formula C20H20N2O2 and a molecular weight of 320.4 g/mol. IUPAC name: 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethylpropanamide. InChIKey: JZMZNOFEMDPCKX-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)-N,N-dimethylpropanamide |
| InChIKey | JZMZNOFEMDPCKX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCC1=NC(=C(O1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Nurr1 agonist 11, orb2663967