Products 1090385-94-6
CAS 1090385-94-6 is the registry number for 1-(2-Fluorophenyl)cyclopentane-1-carboxamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
1-(2-fluorophenyl)cyclopentane-1-carboxamide (CAS 1090385-94-6) is a chemical compound with the molecular formula C12H14FNO and a molecular weight of 207.24 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopentane-1-carboxamide. InChIKey: XPZWKOXDEOJMPG-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopentane-1-carboxamide |
| InChIKey | XPZWKOXDEOJMPG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2F)C(=O)N |
Computed by PubChem (NCBI)