Products 127199-12-6
CAS 127199-12-6 is the registry number for Cis-2-fluorocyclopropyl)-n-((r)-1-phenylethyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Cis-(1R,2R)-2-fluoro-N-[(1R)-1-phenylethyl]cyclopropane-1-carboxamide (CAS 127199-12-6) is a chemical compound with the molecular formula C12H14FNO and a molecular weight of 207.24 g/mol. IUPAC name: cis-(1R,2R)-2-fluoro-N-[(1R)-1-phenylethyl]cyclopropane-1-carboxamide. InChIKey: XWUIVRLWEGBPDB-DVVUODLYSA-N.
| Molecular formula | C12H14FNO |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | cis-(1R,2R)-2-fluoro-N-[(1R)-1-phenylethyl]cyclopropane-1-carboxamide |
| InChIKey | XWUIVRLWEGBPDB-DVVUODLYSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)[C@H]2C[C@H]2F |
Computed by PubChem (NCBI)