CAS 1170613-55-4 appears in our catalog under these names: (1E,3E)-1-(4-Fluorophenyl)-2-methyl-1-penten-3-one oxime, 95%, (1E,3E)-1-(4-Fluorophenyl)-2-methyl-1-penten-3-one Oxime, A 967079, A-967079/ 99.75% (existing batch purity), 1-Penten-3-one, 1-(4-fluorophenyl)-2-methyl-, oxime, (1E,3E)-, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 250mg, 50 mg.
(NE)-N-[(E)-1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine (CAS 1170613-55-4) is a chemical compound with the molecular formula C12H14FNO and a molecular weight of 207.24 g/mol. IUPAC name: (NE)-N-[(E)-1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine. InChIKey: HKROEBDHHKMNBZ-CHBKHGQFSA-N.
| Molecular formula | C12H14FNO |
|---|---|
| Molecular weight | 207.24 g/mol |
| IUPAC name | (NE)-N-[(E)-1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine |
| InChIKey | HKROEBDHHKMNBZ-CHBKHGQFSA-N |
| SMILES | CC/C(=N\O)/C(=C/C1=CC=C(C=C1)F)/C |
Computed by PubChem (NCBI)