CAS 1090391-32-4 is the registry number for N-(6-(1H-1,2,4-Triazol-1-yl)pyridin-3-yl)isobutyramide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide (CAS 1090391-32-4) is a chemical compound with the molecular formula C11H13N5O and a molecular weight of 231.25 g/mol. IUPAC name: 2-methyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide. InChIKey: SVKVFSQUIMKIBF-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-methyl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide |
| InChIKey | SVKVFSQUIMKIBF-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CN=C(C=C1)N2C=NC=N2 |
Computed by PubChem (NCBI)