CAS 329213-13-0 appears in our catalog under these names: N-(8-Methoxy-4-methylquinazolin-2-yl)guanidine, 95%, N-(8-Methoxy-4-methylquinazolin-2-yl)guanidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g.
2-(8-methoxy-4-methylquinazolin-2-yl)guanidine (CAS 329213-13-0) is a chemical compound with the molecular formula C11H13N5O and a molecular weight of 231.25 g/mol. IUPAC name: 2-(8-methoxy-4-methylquinazolin-2-yl)guanidine. InChIKey: UCVBIIAYDZYJNW-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-(8-methoxy-4-methylquinazolin-2-yl)guanidine |
| InChIKey | UCVBIIAYDZYJNW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=C(C2=NC(=N1)N=C(N)N)OC |
Computed by PubChem (NCBI)