CAS 63722-86-1 is the registry number for 4,5-Diamino-6-(benzylamino)pyrimidin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
5,6-diamino-4-(benzylamino)-1H-pyrimidin-2-one (CAS 63722-86-1) is a chemical compound with the molecular formula C11H13N5O and a molecular weight of 231.25 g/mol. IUPAC name: 5,6-diamino-4-(benzylamino)-1H-pyrimidin-2-one. InChIKey: JJYQKLAGLQKARA-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 5,6-diamino-4-(benzylamino)-1H-pyrimidin-2-one |
| InChIKey | JJYQKLAGLQKARA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=O)NC(=C2N)N |
Computed by PubChem (NCBI)