Products 1090610-51-7
CAS 1090610-51-7 is the registry number for Methyl 4-fluoro-3-pivalamidobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2,2-dimethylpropanoylamino)-4-fluorobenzoate (CAS 1090610-51-7) is a chemical compound with the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. IUPAC name: methyl 3-(2,2-dimethylpropanoylamino)-4-fluorobenzoate. InChIKey: DVXSBVNJRORXAJ-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO3 |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | methyl 3-(2,2-dimethylpropanoylamino)-4-fluorobenzoate |
| InChIKey | DVXSBVNJRORXAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC(=C1)C(=O)OC)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl 4-fluoro-3-pivalamidobenzoate