Products 1091606-66-4
CAS 1091606-66-4 is the registry number for (4S,5R)-3,3a,8,8a-Tetrahydroindeno[1,2-d]-1,2,3-oxathiazole-2,2-dioxide-3-carboxylic acid t-butyl ester, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Tert-butyl (3aR,8bS)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate (CAS 1091606-66-4) is a chemical compound with the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. IUPAC name: tert-butyl (3aR,8bS)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate. InChIKey: HKPQLZKNLFNSFK-NEPJUHHUSA-N.
| Molecular formula | C14H17NO5S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | tert-butyl (3aR,8bS)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate |
| InChIKey | HKPQLZKNLFNSFK-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2[C@@H](CC3=CC=CC=C23)OS1(=O)=O |
Computed by PubChem (NCBI)