Products 1391532-95-8
CAS 1391532-95-8 is the registry number for tert-Butyl (3aR,8aS)-8,8a-dihydroindeno[1,2-d][1,2,3]oxathiazole-3(3aH)-carboxylate 2,2-dioxide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aS,8bR)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate (CAS 1391532-95-8) is a chemical compound with the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. IUPAC name: tert-butyl (3aS,8bR)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate. InChIKey: HKPQLZKNLFNSFK-NWDGAFQWSA-N.
| Molecular formula | C14H17NO5S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | tert-butyl (3aS,8bR)-2,2-dioxo-4,8b-dihydro-3aH-indeno[1,2-d]oxathiazole-1-carboxylate |
| InChIKey | HKPQLZKNLFNSFK-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2[C@H](CC3=CC=CC=C23)OS1(=O)=O |
Computed by PubChem (NCBI)