CAS 868964-09-4 appears in our catalog under these names: 3-[(1-Propionyl-2,3-dihydro-1h-indol-5-yl)sulfonyl]propanoic acid, 95%, 3-((1-Propionylindolin-5-yl)sulfonyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid (CAS 868964-09-4) is a chemical compound with the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. IUPAC name: 3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid. InChIKey: LYKPOFRVNYMZGB-UHFFFAOYSA-N.
| Molecular formula | C14H17NO5S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | 3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonyl]propanoic acid |
| InChIKey | LYKPOFRVNYMZGB-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1CCC2=C1C=CC(=C2)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)