Products 324779-72-8

CAS 324779-72-8 is the registry number for (2E)-3-[4-Methoxy-3-(pyrrolidin-1-ylsulfonyl)phenyl]acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(E)-3-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoic acid (CAS 324779-72-8) is a chemical compound with the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. IUPAC name: (E)-3-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoic acid. InChIKey: YYPLTSZGZCLXHC-FNORWQNLSA-N.

Identity
Molecular formulaC14H17NO5S
Molecular weight311.36 g/mol
IUPAC name(E)-3-(4-methoxy-3-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoic acid
InChIKeyYYPLTSZGZCLXHC-FNORWQNLSA-N
SMILESCOC1=C(C=C(C=C1)/C=C/C(=O)O)S(=O)(=O)N2CCCC2

Computed by PubChem (NCBI)