CAS 1091606-67-5 appears in our catalog under these names: (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethylamine, 97%, (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethanamine, (1S,2S)-2-(Diphenylphosphino)-1,2-diphenylethanamine, 97%, 98% ee. Offered by: Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 250MG, 25mg, 100mg, 1g.
(1S,2S)-2-diphenylphosphanyl-1,2-diphenylethanamine (CAS 1091606-67-5) is a chemical compound with the molecular formula C26H24NP and a molecular weight of 381.4 g/mol. IUPAC name: (1S,2S)-2-diphenylphosphanyl-1,2-diphenylethanamine. InChIKey: MIPGTOGPLXZBQX-UIOOFZCWSA-N.
| Molecular formula | C26H24NP |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (1S,2S)-2-diphenylphosphanyl-1,2-diphenylethanamine |
| InChIKey | MIPGTOGPLXZBQX-UIOOFZCWSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)