CAS 1091606-68-6 appears in our catalog under these names: (1R,2R)-2-(Diphenylphosphino)-1,2-diphenylethanamine, 95%, (1R,2R)–2–(Diphenylphosphino)–1,2–diphenylethanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(1R,2R)-2-diphenylphosphanyl-1,2-diphenylethanamine (CAS 1091606-68-6) is a chemical compound with the molecular formula C26H24NP and a molecular weight of 381.4 g/mol. IUPAC name: (1R,2R)-2-diphenylphosphanyl-1,2-diphenylethanamine. InChIKey: MIPGTOGPLXZBQX-CLJLJLNGSA-N.
| Molecular formula | C26H24NP |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (1R,2R)-2-diphenylphosphanyl-1,2-diphenylethanamine |
| InChIKey | MIPGTOGPLXZBQX-CLJLJLNGSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@@H](C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)