CAS 636987-17-2 is the registry number for (R)-2'-(Diphenylphosphino)-6,6'-dimethyl-[1,1'-biphenyl]-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylaniline (CAS 636987-17-2) is a chemical compound with the molecular formula C26H24NP and a molecular weight of 381.4 g/mol. IUPAC name: 2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylaniline. InChIKey: GQBQXVQXSXTRRP-UHFFFAOYSA-N.
| Molecular formula | C26H24NP |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 2-(2-diphenylphosphanyl-6-methylphenyl)-3-methylaniline |
| InChIKey | GQBQXVQXSXTRRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N)C2=C(C=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)