CAS 1092120-21-2 appears in our catalog under these names: 6-Bromo-5-methoxy-1,3-benzothiazol-2-amine, 6-Bromo-5-methoxy-1,3-benzothiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-5-methoxy-1,3-benzothiazol-2-amine (CAS 1092120-21-2) is a chemical compound with the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. IUPAC name: 6-bromo-5-methoxy-1,3-benzothiazol-2-amine. InChIKey: NNHNIBUSODSJMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2OS |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 6-bromo-5-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | NNHNIBUSODSJMQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)N)Br |
Computed by PubChem (NCBI)