CAS 1313712-31-0 appears in our catalog under these names: 7-Bromo-2,6-dimethyl-thieno[3,2-d]pyrimidin-4-ol, 95%, 7-Bromo-2,6-dimethyl-1h-thieno[3,2-d]pyrimidin-4-one, 95%, 7-Bromo-2,6-dimethyl-3h-thieno[3,2-d]pyrimidin-4-one, 95%, 7-Bromo-2,6-dimethylthieno(3,2-d)pyrimidin-4(3H)-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
7-bromo-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1313712-31-0) is a chemical compound with the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. IUPAC name: 7-bromo-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: SZGLAAAJAIDMRW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2OS |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 7-bromo-2,6-dimethyl-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | SZGLAAAJAIDMRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)C(=O)NC(=N2)C)Br |
Computed by PubChem (NCBI)