CAS 383865-53-0 appears in our catalog under these names: 7-Bromo-4-methoxy-1,3-benzothiazol-2-amine, 95%, 7-Bromo-4-methoxy-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
7-bromo-4-methoxy-1,3-benzothiazol-2-amine (CAS 383865-53-0) is a chemical compound with the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. IUPAC name: 7-bromo-4-methoxy-1,3-benzothiazol-2-amine. InChIKey: FUTJCKPBRSQTAW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2OS |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 7-bromo-4-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | FUTJCKPBRSQTAW-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Br)SC(=N2)N |
Computed by PubChem (NCBI)